C20H22BrNOS — CID 90704045
(4S)-1-[(1R)-1-(4-bromophenyl)ethyl]-4-prop-2-enyl-4-thiophen-2-ylpiperidin-2-one (PubChem CID 90704045) has the molecular formula C20H22BrNOS and a molecular weight of 404.37 g/mol. Its IUPAC name is (4S)-1-[(1R)-1-(4-bromophenyl)ethyl]-4-prop-2-enyl-4-thiophen-2-ylpiperidin-2-one.
| Compound Name | (4S)-1-[(1R)-1-(4-bromophenyl)ethyl]-4-prop-2-enyl-4-thiophen-2-ylpiperidin-2-one |
|---|---|
| PubChem CID | 90704045 |
| Molecular Formula | C20H22BrNOS |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | (4S)-1-[(1R)-1-(4-bromophenyl)ethyl]-4-prop-2-enyl-4-thiophen-2-ylpiperidin-2-one |
| SMILES | C=CC[C@]1(c2cccs2)CCN([C@H](C)c2ccc(Br)cc2)C(=O)C1 |
| InChI | InChI=1S/C20H22BrNOS/c1-3-10-20(18-5-4-13-24-18)11-12-22(19(23)14-20)15(2)16-6-8-17(21)9-7-16/h3-9,13,15H,1,10-12,14H2,2H3/t15-,20+/m1/s1 |
| InChIKey | OEVNUMNTQHTEBN-QRWLVFNGSA-N |
| XLogP | 5.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|