C22H30FNO — CID 91142930
(4S)-1-[(1R)-1-cyclohexylethyl]-4-(4-fluorophenyl)-4-prop-2-enylpiperidin-2-one (PubChem CID 91142930) has the molecular formula C22H30FNO and a molecular weight of 343.49 g/mol. Its IUPAC name is (4S)-1-[(1R)-1-cyclohexylethyl]-4-(4-fluorophenyl)-4-prop-2-enylpiperidin-2-one.
| Compound Name | (4S)-1-[(1R)-1-cyclohexylethyl]-4-(4-fluorophenyl)-4-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 91142930 |
| Molecular Formula | C22H30FNO |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (4S)-1-[(1R)-1-cyclohexylethyl]-4-(4-fluorophenyl)-4-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@]1(c2ccc(F)cc2)CCN([C@H](C)C2CCCCC2)C(=O)C1 |
| InChI | InChI=1S/C22H30FNO/c1-3-13-22(19-9-11-20(23)12-10-19)14-15-24(21(25)16-22)17(2)18-7-5-4-6-8-18/h3,9-12,17-18H,1,4-8,13-16H2,2H3/t17-,22+/m1/s1 |
| InChIKey | OLCICCICZKTJHN-VGSWGCGISA-N |
| XLogP | 5.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|