C22H34FN3O3S — CID 68733854
N-[3-[1-(1-cyclohexylethyl)-4-(4-fluorophenyl)-2-oxo-1,3-diazinan-4-yl]propyl]methanesulfonamide (PubChem CID 68733854) has the molecular formula C22H34FN3O3S and a molecular weight of 439.60 g/mol. Its IUPAC name is N-[3-[1-(1-cyclohexylethyl)-4-(4-fluorophenyl)-2-oxo-1,3-diazinan-4-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[1-(1-cyclohexylethyl)-4-(4-fluorophenyl)-2-oxo-1,3-diazinan-4-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 68733854 |
| Molecular Formula | C22H34FN3O3S |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-[3-[1-(1-cyclohexylethyl)-4-(4-fluorophenyl)-2-oxo-1,3-diazinan-4-yl]propyl]methanesulfonamide |
| SMILES | CC(C1CCCCC1)N1CCC(CCCNS(C)(=O)=O)(c2ccc(F)cc2)NC1=O |
| InChI | InChI=1S/C22H34FN3O3S/c1-17(18-7-4-3-5-8-18)26-16-14-22(25-21(26)27,13-6-15-24-30(2,28)29)19-9-11-20(23)12-10-19/h9-12,17-18,24H,3-8,13-16H2,1-2H3,(H,25,27) |
| InChIKey | ZYEYDOUGNUMNTG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|