C22H26BrFN2O4S — CID 87554341
3-[(4S)-1-[(1S)-1-(4-bromophenyl)ethyl]-4-(4-fluorophenyl)-2-oxo-1,3-diazinan-4-yl]propyl methanesulfonate (PubChem CID 87554341) has the molecular formula C22H26BrFN2O4S and a molecular weight of 513.43 g/mol. Its IUPAC name is 3-[(4S)-1-[(1S)-1-(4-bromophenyl)ethyl]-4-(4-fluorophenyl)-2-oxo-1,3-diazinan-4-yl]propyl methanesulfonate.
| Compound Name | 3-[(4S)-1-[(1S)-1-(4-bromophenyl)ethyl]-4-(4-fluorophenyl)-2-oxo-1,3-diazinan-4-yl]propyl methanesulfonate |
|---|---|
| PubChem CID | 87554341 |
| Molecular Formula | C22H26BrFN2O4S |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | 3-[(4S)-1-[(1S)-1-(4-bromophenyl)ethyl]-4-(4-fluorophenyl)-2-oxo-1,3-diazinan-4-yl]propyl methanesulfonate |
| SMILES | C[C@@H](c1ccc(Br)cc1)N1CC[C@@](CCCOS(C)(=O)=O)(c2ccc(F)cc2)NC1=O |
| InChI | InChI=1S/C22H26BrFN2O4S/c1-16(17-4-8-19(23)9-5-17)26-14-13-22(25-21(26)27,12-3-15-30-31(2,28)29)18-6-10-20(24)11-7-18/h4-11,16H,3,12-15H2,1-2H3,(H,25,27)/t16-,22-/m0/s1 |
| InChIKey | HDFVGQIWDVGZKW-AOMKIAJQSA-N |
| XLogP | 4.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|