C24H36O7 — CID 90704515
[(1S,4R,5S,6R)-4,5-diacetyloxy-6-[(2R)-6-hydroxy-6-methylhept-4-en-2-yl]-3-methylcyclohex-2-en-1-yl] 2-methylbut-2-enoate (PubChem CID 90704515) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(1S,4R,5S,6R)-4,5-diacetyloxy-6-[(2R)-6-hydroxy-6-methylhept-4-en-2-yl]-3-methylcyclohex-2-en-1-yl] 2-methylbut-2-enoate.
| Compound Name | [(1S,4R,5S,6R)-4,5-diacetyloxy-6-[(2R)-6-hydroxy-6-methylhept-4-en-2-yl]-3-methylcyclohex-2-en-1-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 90704515 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(1S,4R,5S,6R)-4,5-diacetyloxy-6-[(2R)-6-hydroxy-6-methylhept-4-en-2-yl]-3-methylcyclohex-2-en-1-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@H]1C=C(C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1[C@H](C)CC=CC(C)(C)O |
| InChI | InChI=1S/C24H36O7/c1-9-14(2)23(27)31-19-13-16(4)21(29-17(5)25)22(30-18(6)26)20(19)15(3)11-10-12-24(7,8)28/h9-10,12-13,15,19-22,28H,11H2,1-8H3/t15-,19+,20-,21-,22+/m1/s1 |
| InChIKey | JFDZYIQQSHIQHS-ZYXNFWPYSA-N |
| XLogP | 3.66 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|