C11H22OS — CID 90707038
(4S,5S)-2-ethyl-3,4,5-trimethyl-6-methylsulfanyloxane (PubChem CID 90707038) has the molecular formula C11H22OS and a molecular weight of 202.36 g/mol. Its IUPAC name is (4S,5S)-2-ethyl-3,4,5-trimethyl-6-methylsulfanyloxane.
| Compound Name | (4S,5S)-2-ethyl-3,4,5-trimethyl-6-methylsulfanyloxane |
|---|---|
| PubChem CID | 90707038 |
| Molecular Formula | C11H22OS |
| Molecular Weight | 202.36 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (4S,5S)-2-ethyl-3,4,5-trimethyl-6-methylsulfanyloxane |
| SMILES | CCC1OC(SC)[C@@H](C)[C@@H](C)C1C |
| InChI | InChI=1S/C11H22OS/c1-6-10-8(3)7(2)9(4)11(12-10)13-5/h7-11H,6H2,1-5H3/t7-,8?,9-,10?,11?/m0/s1 |
| InChIKey | LAXHPRHDINDQMZ-DPFQSYNXSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |