C9H17FOS — CID 54472326
(3S)-5-fluoro-2,3,4-trimethyl-6-methylsulfanyloxane (PubChem CID 54472326) has the molecular formula C9H17FOS and a molecular weight of 192.30 g/mol. Its IUPAC name is (3S)-5-fluoro-2,3,4-trimethyl-6-methylsulfanyloxane.
| Compound Name | (3S)-5-fluoro-2,3,4-trimethyl-6-methylsulfanyloxane |
|---|---|
| PubChem CID | 54472326 |
| Molecular Formula | C9H17FOS |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (3S)-5-fluoro-2,3,4-trimethyl-6-methylsulfanyloxane |
| SMILES | CSC1OC(C)[C@@H](C)C(C)C1F |
| InChI | InChI=1S/C9H17FOS/c1-5-6(2)8(10)9(12-4)11-7(5)3/h5-9H,1-4H3/t5-,6?,7?,8?,9?/m0/s1 |
| InChIKey | XJEXGHQBDTYBLX-OQOOARCMSA-N |
| XLogP | 2.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |