C17H33N5O2 — CID 90707121
(2R)-2-amino-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-morpholin-4-ylpropan-1-one (PubChem CID 90707121) has the molecular formula C17H33N5O2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-morpholin-4-ylpropan-1-one.
| Compound Name | (2R)-2-amino-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 90707121 |
| Molecular Formula | C17H33N5O2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (2R)-2-amino-1-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]-2-morpholin-4-ylpropan-1-one |
| SMILES | CN1CCC(N2CCN(C(=O)[C@](C)(N)N3CCOCC3)CC2)CC1 |
| InChI | InChI=1S/C17H33N5O2/c1-17(18,22-11-13-24-14-12-22)16(23)21-9-7-20(8-10-21)15-3-5-19(2)6-4-15/h15H,3-14,18H2,1-2H3/t17-/m1/s1 |
| InChIKey | QQBFABCIFWOLOJ-QGZVFWFLSA-N |
| XLogP | -0.77 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |