C13H12FNO2 — CID 90708312
1-[2-(4-fluorophenyl)cyclopropyl]pyrrole-2,5-diol (PubChem CID 90708312) has the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)cyclopropyl]pyrrole-2,5-diol.
| Compound Name | 1-[2-(4-fluorophenyl)cyclopropyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90708312 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 1-[2-(4-fluorophenyl)cyclopropyl]pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1C1CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FNO2/c14-9-3-1-8(2-4-9)10-7-11(10)15-12(16)5-6-13(15)17/h1-6,10-11,16-17H,7H2 |
| InChIKey | YSUYMLOEJHVFLT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |