About (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene
(E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene (PubChem CID 90708717) has the molecular formula C12H20F4O2
and a molecular weight of 272.28 g/mol. Its IUPAC name is (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene.
Molecular Properties
| Compound Name | (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene |
| PubChem CID | 90708717 |
| Molecular Formula | C12H20F4O2 |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene |
| SMILES | C/C=C/C(F)(F)OC.CCC/C=C/C(F)(F)OC |
| InChI | InChI=1S/C7H12F2O.C5H8F2O/c1-3-4-5-6-7(8,9)10-2;1-3-4-5(6,7)8-2/h5-6H,3-4H2,1-2H3;3-4H,1-2H3/b6-5+;4-3+ |
| InChIKey | PMPIJQAXWNMHSG-YPXSKRLGSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene?
The IUPAC name of (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene (CID 90708717) is (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene.
What is the SMILES notation for (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene?
The canonical SMILES for (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene is C/C=C/C(F)(F)OC.CCC/C=C/C(F)(F)OC.
What is the InChIKey of (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene?
The InChIKey is PMPIJQAXWNMHSG-YPXSKRLGSA-N. The full InChI is InChI=1S/C7H12F2O.C5H8F2O/c1-3-4-5-6-7(8,9)10-2;1-3-4-5(6,7)8-2/h5-6H,3-4H2,1-2H3;3-4H,1-2H3/b6-5+;4-3+.
What are the key properties of (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene?
(E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene has a molecular weight of 272.28 g/mol, XLogP of 4.38, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1-difluoro-1-methoxybut-2-ene;(E)-1,1-difluoro-1-methoxyhex-2-ene is sourced from PubChem (CID 90708717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).