C19H29N4O4S+ — CID 9070922
2-[4-(4-ethylpiperazin-4-ium-1-carbonyl)piperidin-1-yl]sulfonylbenzamide (PubChem CID 9070922) has the molecular formula C19H29N4O4S+ and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-[4-(4-ethylpiperazin-4-ium-1-carbonyl)piperidin-1-yl]sulfonylbenzamide.
| Compound Name | 2-[4-(4-ethylpiperazin-4-ium-1-carbonyl)piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 9070922 |
| Molecular Formula | C19H29N4O4S+ |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-[4-(4-ethylpiperazin-4-ium-1-carbonyl)piperidin-1-yl]sulfonylbenzamide |
| SMILES | CC[NH+]1CCN(C(=O)C2CCN(S(=O)(=O)c3ccccc3C(N)=O)CC2)CC1 |
| InChI | InChI=1S/C19H28N4O4S/c1-2-21-11-13-22(14-12-21)19(25)15-7-9-23(10-8-15)28(26,27)17-6-4-3-5-16(17)18(20)24/h3-6,15H,2,7-14H2,1H3,(H2,20,24)/p+1 |
| InChIKey | SNQJAMHRSHZQAR-UHFFFAOYSA-O |
| XLogP | -1.07 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |