C19H28N4O5S — CID 8547395
N-[2-(tert-butylamino)-2-oxoethyl]-1-(2-carbamoylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 8547395) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-1-(2-carbamoylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-1-(2-carbamoylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 8547395 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-1-(2-carbamoylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)C1CCN(S(=O)(=O)c2ccccc2C(N)=O)CC1 |
| InChI | InChI=1S/C19H28N4O5S/c1-19(2,3)22-16(24)12-21-18(26)13-8-10-23(11-9-13)29(27,28)15-7-5-4-6-14(15)17(20)25/h4-7,13H,8-12H2,1-3H3,(H2,20,25)(H,21,26)(H,22,24) |
| InChIKey | HSCWGEXQCSEFAZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |