C22H30N4O5S — CID 55727273
methyl 2-[4-[(2-tert-butyl-5-methylpyrazol-3-yl)carbamoyl]piperidin-1-yl]sulfonylbenzoate (PubChem CID 55727273) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is methyl 2-[4-[(2-tert-butyl-5-methylpyrazol-3-yl)carbamoyl]piperidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 2-[4-[(2-tert-butyl-5-methylpyrazol-3-yl)carbamoyl]piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 55727273 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | methyl 2-[4-[(2-tert-butyl-5-methylpyrazol-3-yl)carbamoyl]piperidin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)N1CCC(C(=O)Nc2cc(C)nn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C22H30N4O5S/c1-15-14-19(26(24-15)22(2,3)4)23-20(27)16-10-12-25(13-11-16)32(29,30)18-9-7-6-8-17(18)21(28)31-5/h6-9,14,16H,10-13H2,1-5H3,(H,23,27) |
| InChIKey | BTSKBAZYELBNOP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |