C20H19F3N2O3 — CID 90710305
5-morpholin-4-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 90710305) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is 5-morpholin-4-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 5-morpholin-4-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90710305 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 5-morpholin-4-yl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | Oc1c2ccc(N3CCOCC3)cc2cn1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3N2O3/c21-20(22,23)28-17-4-1-14(2-5-17)12-25-13-15-11-16(3-6-18(15)19(25)26)24-7-9-27-10-8-24/h1-6,11,13,26H,7-10,12H2 |
| InChIKey | WYNJIXHEWSUYTH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |