C7H7NO4 — CID 90711575
1-methoxy-2-oxopyridine-3-carboxylic acid (PubChem CID 90711575) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is 1-methoxy-2-oxopyridine-3-carboxylic acid.
| Compound Name | 1-methoxy-2-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 90711575 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 1-methoxy-2-oxopyridine-3-carboxylic acid |
| SMILES | COn1cccc(C(=O)O)c1=O |
| InChI | InChI=1S/C7H7NO4/c1-12-8-4-2-3-5(6(8)9)7(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | OZYFTLMQMSFHGX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |