C18H20N2O5 — CID 82108087
1-[2-(4-butan-2-ylanilino)-2-oxoethoxy]-2-oxopyridine-3-carboxylic acid (PubChem CID 82108087) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 1-[2-(4-butan-2-ylanilino)-2-oxoethoxy]-2-oxopyridine-3-carboxylic acid.
| Compound Name | 1-[2-(4-butan-2-ylanilino)-2-oxoethoxy]-2-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 82108087 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-[2-(4-butan-2-ylanilino)-2-oxoethoxy]-2-oxopyridine-3-carboxylic acid |
| SMILES | CCC(C)c1ccc(NC(=O)COn2cccc(C(=O)O)c2=O)cc1 |
| InChI | InChI=1S/C18H20N2O5/c1-3-12(2)13-6-8-14(9-7-13)19-16(21)11-25-20-10-4-5-15(17(20)22)18(23)24/h4-10,12H,3,11H2,1-2H3,(H,19,21)(H,23,24) |
| InChIKey | GXCLLUUWCGCRGZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |