C21H22N2O2 — CID 9354346
N-[4-[(2S)-butan-2-yl]phenyl]-2-(1-oxoisoquinolin-2-yl)acetamide (PubChem CID 9354346) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[4-[(2S)-butan-2-yl]phenyl]-2-(1-oxoisoquinolin-2-yl)acetamide.
| Compound Name | N-[4-[(2S)-butan-2-yl]phenyl]-2-(1-oxoisoquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 9354346 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-[4-[(2S)-butan-2-yl]phenyl]-2-(1-oxoisoquinolin-2-yl)acetamide |
| SMILES | CC[C@H](C)c1ccc(NC(=O)Cn2ccc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C21H22N2O2/c1-3-15(2)16-8-10-18(11-9-16)22-20(24)14-23-13-12-17-6-4-5-7-19(17)21(23)25/h4-13,15H,3,14H2,1-2H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | UMCDMQKBVYGAHL-HNNXBMFYSA-N |
| XLogP | 4.15 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |