C17H27NO14S-2 — CID 90712553
(2R,3R,5R)-5-[(3R,4R,6R)-5-acetamido-2-(hydroxymethyl)-6-methoxy-3-oxidoperoxysulfanyloxyoxan-4-yl]oxy-3,4-dihydroxy-2-methoxycyclohexane-1-carboxylate (PubChem CID 90712553) has the molecular formula C17H27NO14S-2 and a molecular weight of 501.46 g/mol. Its IUPAC name is (2R,3R,5R)-5-[(3R,4R,6R)-5-acetamido-2-(hydroxymethyl)-6-methoxy-3-oxidoperoxysulfanyloxyoxan-4-yl]oxy-3,4-dihydroxy-2-methoxycyclohexane-1-carboxylate.
| Compound Name | (2R,3R,5R)-5-[(3R,4R,6R)-5-acetamido-2-(hydroxymethyl)-6-methoxy-3-oxidoperoxysulfanyloxyoxan-4-yl]oxy-3,4-dihydroxy-2-methoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90712553 |
| Molecular Formula | C17H27NO14S-2 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | (2R,3R,5R)-5-[(3R,4R,6R)-5-acetamido-2-(hydroxymethyl)-6-methoxy-3-oxidoperoxysulfanyloxyoxan-4-yl]oxy-3,4-dihydroxy-2-methoxycyclohexane-1-carboxylate |
| SMILES | CO[C@@H]1OC(CO)[C@H](OSOO[O-])[C@H](O[C@@H]2CC(C(=O)[O-])[C@@H](OC)[C@H](O)C2O)C1NC(C)=O |
| InChI | InChI=1S/C17H29NO14S/c1-6(20)18-10-15(14(30-33-32-31-25)9(5-19)29-17(10)27-3)28-8-4-7(16(23)24)13(26-2)12(22)11(8)21/h7-15,17,19,21-22,25H,4-5H2,1-3H3,(H,18,20)(H,23,24)/p-2/t7?,8-,9?,10?,11?,12-,13-,14+,15-,17-/m1/s1 |
| InChIKey | RXERWXSGWJSXST-GNJPMUNVSA-L |
| XLogP | -4.71 |
| TPSA | 217.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|