C17H27NO14S-2 — CID 90992439
(2R,3R,5R)-5-[(2R,4R,5R)-3-acetamido-5-hydroxy-2-methoxy-6-(sulfonatooxymethyl)oxan-4-yl]oxy-3,4-dihydroxy-2-methoxycyclohexane-1-carboxylate (PubChem CID 90992439) has the molecular formula C17H27NO14S-2 and a molecular weight of 501.46 g/mol. Its IUPAC name is (2R,3R,5R)-5-[(2R,4R,5R)-3-acetamido-5-hydroxy-2-methoxy-6-(sulfonatooxymethyl)oxan-4-yl]oxy-3,4-dihydroxy-2-methoxycyclohexane-1-carboxylate.
| Compound Name | (2R,3R,5R)-5-[(2R,4R,5R)-3-acetamido-5-hydroxy-2-methoxy-6-(sulfonatooxymethyl)oxan-4-yl]oxy-3,4-dihydroxy-2-methoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90992439 |
| Molecular Formula | C17H27NO14S-2 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | (2R,3R,5R)-5-[(2R,4R,5R)-3-acetamido-5-hydroxy-2-methoxy-6-(sulfonatooxymethyl)oxan-4-yl]oxy-3,4-dihydroxy-2-methoxycyclohexane-1-carboxylate |
| SMILES | CO[C@@H]1OC(COS(=O)(=O)[O-])[C@H](O)[C@H](O[C@@H]2CC(C(=O)[O-])[C@@H](OC)[C@H](O)C2O)C1NC(C)=O |
| InChI | InChI=1S/C17H29NO14S/c1-6(19)18-10-15(12(21)9(32-17(10)29-3)5-30-33(25,26)27)31-8-4-7(16(23)24)14(28-2)13(22)11(8)20/h7-15,17,20-22H,4-5H2,1-3H3,(H,18,19)(H,23,24)(H,25,26,27)/p-2/t7?,8-,9?,10?,11?,12+,13-,14-,15-,17-/m1/s1 |
| InChIKey | XAQFPZGWGWOAQE-ZGUOIMDZSA-L |
| XLogP | -5.04 |
| TPSA | 233.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | -5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|