C22H30F3N5O3 — CID 90713007
2-[[4-[amino-(2,4,5-trifluorophenyl)methylidene]-1-methylpiperidin-3-ylidene]carbamoylamino]-N-(2-hydroxyethyl)-3,3-dimethylbutanamide (PubChem CID 90713007) has the molecular formula C22H30F3N5O3 and a molecular weight of 469.51 g/mol. Its IUPAC name is 2-[[4-[amino-(2,4,5-trifluorophenyl)methylidene]-1-methylpiperidin-3-ylidene]carbamoylamino]-N-(2-hydroxyethyl)-3,3-dimethylbutanamide.
| Compound Name | 2-[[4-[amino-(2,4,5-trifluorophenyl)methylidene]-1-methylpiperidin-3-ylidene]carbamoylamino]-N-(2-hydroxyethyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 90713007 |
| Molecular Formula | C22H30F3N5O3 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[[4-[amino-(2,4,5-trifluorophenyl)methylidene]-1-methylpiperidin-3-ylidene]carbamoylamino]-N-(2-hydroxyethyl)-3,3-dimethylbutanamide |
| SMILES | CN1CCC(=C(N)c2cc(F)c(F)cc2F)C(=NC(=O)NC(C(=O)NCCO)C(C)(C)C)C1 |
| InChI | InChI=1S/C22H30F3N5O3/c1-22(2,3)19(20(32)27-6-8-31)29-21(33)28-17-11-30(4)7-5-12(17)18(26)13-9-15(24)16(25)10-14(13)23/h9-10,19,31H,5-8,11,26H2,1-4H3,(H,27,32)(H,29,33) |
| InChIKey | CWKOEEFABNPLBP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|