C24H35F2N5O3 — CID 90819074
2-[[3-[amino-(3,4-difluorophenyl)methylidene]oxan-4-ylidene]carbamoylamino]-N-[3-(dimethylamino)propyl]-3,3-dimethylbutanamide (PubChem CID 90819074) has the molecular formula C24H35F2N5O3 and a molecular weight of 479.57 g/mol. Its IUPAC name is 2-[[3-[amino-(3,4-difluorophenyl)methylidene]oxan-4-ylidene]carbamoylamino]-N-[3-(dimethylamino)propyl]-3,3-dimethylbutanamide.
| Compound Name | 2-[[3-[amino-(3,4-difluorophenyl)methylidene]oxan-4-ylidene]carbamoylamino]-N-[3-(dimethylamino)propyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 90819074 |
| Molecular Formula | C24H35F2N5O3 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 2-[[3-[amino-(3,4-difluorophenyl)methylidene]oxan-4-ylidene]carbamoylamino]-N-[3-(dimethylamino)propyl]-3,3-dimethylbutanamide |
| SMILES | CN(C)CCCNC(=O)C(NC(=O)N=C1CCOCC1=C(N)c1ccc(F)c(F)c1)C(C)(C)C |
| InChI | InChI=1S/C24H35F2N5O3/c1-24(2,3)21(22(32)28-10-6-11-31(4)5)30-23(33)29-19-9-12-34-14-16(19)20(27)15-7-8-17(25)18(26)13-15/h7-8,13,21H,6,9-12,14,27H2,1-5H3,(H,28,32)(H,30,33) |
| InChIKey | AQLDAEJXVDIYAE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|