C31H21F6N3O3 — CID 90714125
4-[[3-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dihydroisoindol-2-yl]phenyl]methyl]-2H-phthalazin-1-one (PubChem CID 90714125) has the molecular formula C31H21F6N3O3 and a molecular weight of 597.52 g/mol. Its IUPAC name is 4-[[3-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dihydroisoindol-2-yl]phenyl]methyl]-2H-phthalazin-1-one.
| Compound Name | 4-[[3-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dihydroisoindol-2-yl]phenyl]methyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 90714125 |
| Molecular Formula | C31H21F6N3O3 |
| Molecular Weight | 597.52 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | 4-[[3-[4-[3,5-bis(trifluoromethyl)phenyl]-1,3-dihydroxy-4,7-dihydroisoindol-2-yl]phenyl]methyl]-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cc2cccc(-n3c(O)c4c(c3O)C(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C=CC4)c2)c2ccccc12 |
| InChI | InChI=1S/C31H21F6N3O3/c32-30(33,34)18-13-17(14-19(15-18)31(35,36)37)21-9-4-10-24-26(21)29(43)40(28(24)42)20-6-3-5-16(11-20)12-25-22-7-1-2-8-23(22)27(41)39-38-25/h1-9,11,13-15,21,42-43H,10,12H2,(H,39,41) |
| InChIKey | JZZAWJDCNPMSJX-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.52 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|