C23H24FN3O3 — CID 90815331
4-[[3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]methyl]-5,6,7,8-tetrahydro-2H-phthalazin-1-one (PubChem CID 90815331) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is 4-[[3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]methyl]-5,6,7,8-tetrahydro-2H-phthalazin-1-one.
| Compound Name | 4-[[3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]methyl]-5,6,7,8-tetrahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 90815331 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 4-[[3-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorophenyl]methyl]-5,6,7,8-tetrahydro-2H-phthalazin-1-one |
| SMILES | O=c1[nH]nc(Cc2ccc(F)c(-n3c(O)c4c(c3O)CCCC4)c2)c2c1CCCC2 |
| InChI | InChI=1S/C23H24FN3O3/c24-18-10-9-13(11-19-14-5-1-2-6-15(14)21(28)26-25-19)12-20(18)27-22(29)16-7-3-4-8-17(16)23(27)30/h9-10,12,29-30H,1-8,11H2,(H,26,28) |
| InChIKey | VUDYXUWEANHCDC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |