C16H22O7 — CID 90714140
1,1-bis(2-methylprop-2-enoyloxy)butyl 2-methyl-3-oxopropanoate (PubChem CID 90714140) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is 1,1-bis(2-methylprop-2-enoyloxy)butyl 2-methyl-3-oxopropanoate.
| Compound Name | 1,1-bis(2-methylprop-2-enoyloxy)butyl 2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 90714140 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1,1-bis(2-methylprop-2-enoyloxy)butyl 2-methyl-3-oxopropanoate |
| SMILES | C=C(C)C(=O)OC(CCC)(OC(=O)C(=C)C)OC(=O)C(C)C=O |
| InChI | InChI=1S/C16H22O7/c1-7-8-16(21-13(18)10(2)3,22-14(19)11(4)5)23-15(20)12(6)9-17/h9,12H,2,4,7-8H2,1,3,5-6H3 |
| InChIKey | WTVURHRLUCTQLU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|