C26H23F3N4O4S — CID 90714280
3-[[1-benzyl-2,5-dihydroxy-4-[(2,2,2-trifluoro-1-thiophen-2-ylethylidene)amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 90714280) has the molecular formula C26H23F3N4O4S and a molecular weight of 544.56 g/mol. Its IUPAC name is 3-[[1-benzyl-2,5-dihydroxy-4-[(2,2,2-trifluoro-1-thiophen-2-ylethylidene)amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[1-benzyl-2,5-dihydroxy-4-[(2,2,2-trifluoro-1-thiophen-2-ylethylidene)amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 90714280 |
| Molecular Formula | C26H23F3N4O4S |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 3-[[1-benzyl-2,5-dihydroxy-4-[(2,2,2-trifluoro-1-thiophen-2-ylethylidene)amino]pyrrol-3-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(Nc2c(/N=C(/c3cccs3)C(F)(F)F)c(O)n(Cc3ccccc3)c2O)c1O |
| InChI | InChI=1S/C26H23F3N4O4S/c1-32(2)23(35)16-10-6-11-17(21(16)34)30-19-20(31-22(26(27,28)29)18-12-7-13-38-18)25(37)33(24(19)36)14-15-8-4-3-5-9-15/h3-13,30,34,36-37H,14H2,1-2H3/b31-22- |
| InChIKey | VPFDFHUDSHNKFY-VAMRJTSQSA-N |
| XLogP | 5.84 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|