C24H30ClN5O4 — CID 90714412
N-[1-amino-2-[3-chloro-4-[[2-(dimethylamino)acetyl]amino]-5-methylphenyl]ethylidene]-3-methoxyimino-3-(4-methoxyphenyl)propanamide (PubChem CID 90714412) has the molecular formula C24H30ClN5O4 and a molecular weight of 487.99 g/mol. Its IUPAC name is N-[1-amino-2-[3-chloro-4-[[2-(dimethylamino)acetyl]amino]-5-methylphenyl]ethylidene]-3-methoxyimino-3-(4-methoxyphenyl)propanamide.
| Compound Name | N-[1-amino-2-[3-chloro-4-[[2-(dimethylamino)acetyl]amino]-5-methylphenyl]ethylidene]-3-methoxyimino-3-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 90714412 |
| Molecular Formula | C24H30ClN5O4 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-[1-amino-2-[3-chloro-4-[[2-(dimethylamino)acetyl]amino]-5-methylphenyl]ethylidene]-3-methoxyimino-3-(4-methoxyphenyl)propanamide |
| SMILES | CON=C(CC(=O)/N=C(\N)Cc1cc(C)c(NC(=O)CN(C)C)c(Cl)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H30ClN5O4/c1-15-10-16(11-19(25)24(15)28-23(32)14-30(2)3)12-21(26)27-22(31)13-20(29-34-5)17-6-8-18(33-4)9-7-17/h6-11H,12-14H2,1-5H3,(H,28,32)(H2,26,27,31) |
| InChIKey | WLXKMHABVBNDAV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|