C26H22N2O3 — CID 90717509
methyl 4-(2,4-dimethylphenyl)-2-(fluoren-9-ylidenehydrazinylidene)-4-oxobutanoate (PubChem CID 90717509) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is methyl 4-(2,4-dimethylphenyl)-2-(fluoren-9-ylidenehydrazinylidene)-4-oxobutanoate.
| Compound Name | methyl 4-(2,4-dimethylphenyl)-2-(fluoren-9-ylidenehydrazinylidene)-4-oxobutanoate |
|---|---|
| PubChem CID | 90717509 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | methyl 4-(2,4-dimethylphenyl)-2-(fluoren-9-ylidenehydrazinylidene)-4-oxobutanoate |
| SMILES | COC(=O)C(CC(=O)c1ccc(C)cc1C)=NN=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H22N2O3/c1-16-12-13-18(17(2)14-16)24(29)15-23(26(30)31-3)27-28-25-21-10-6-4-8-19(21)20-9-5-7-11-22(20)25/h4-14H,15H2,1-3H3 |
| InChIKey | ILIDYQCANNCUTO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|