C28H26N2O3 — CID 90858584
methyl 4-(4-butylphenyl)-2-(fluoren-9-ylidenehydrazinylidene)-4-oxobutanoate (PubChem CID 90858584) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is methyl 4-(4-butylphenyl)-2-(fluoren-9-ylidenehydrazinylidene)-4-oxobutanoate.
| Compound Name | methyl 4-(4-butylphenyl)-2-(fluoren-9-ylidenehydrazinylidene)-4-oxobutanoate |
|---|---|
| PubChem CID | 90858584 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | methyl 4-(4-butylphenyl)-2-(fluoren-9-ylidenehydrazinylidene)-4-oxobutanoate |
| SMILES | CCCCc1ccc(C(=O)CC(=NN=C2c3ccccc3-c3ccccc32)C(=O)OC)cc1 |
| InChI | InChI=1S/C28H26N2O3/c1-3-4-9-19-14-16-20(17-15-19)26(31)18-25(28(32)33-2)29-30-27-23-12-7-5-10-21(23)22-11-6-8-13-24(22)27/h5-8,10-17H,3-4,9,18H2,1-2H3 |
| InChIKey | DNKWENKGPYHYER-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|