C19H31F2N3O4 — CID 90718861
N-(1-amino-3-hydroxy-4,4-dimethylpentylidene)-1-(4,4-difluorocyclohexanecarbonyl)-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 90718861) has the molecular formula C19H31F2N3O4 and a molecular weight of 403.47 g/mol. Its IUPAC name is N-(1-amino-3-hydroxy-4,4-dimethylpentylidene)-1-(4,4-difluorocyclohexanecarbonyl)-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | N-(1-amino-3-hydroxy-4,4-dimethylpentylidene)-1-(4,4-difluorocyclohexanecarbonyl)-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90718861 |
| Molecular Formula | C19H31F2N3O4 |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-(1-amino-3-hydroxy-4,4-dimethylpentylidene)-1-(4,4-difluorocyclohexanecarbonyl)-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C(O)C/C(N)=N/C(=O)C1CC(O)CN1C(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H31F2N3O4/c1-18(2,3)14(26)9-15(22)23-16(27)13-8-12(25)10-24(13)17(28)11-4-6-19(20,21)7-5-11/h11-14,25-26H,4-10H2,1-3H3,(H2,22,23,27) |
| InChIKey | QKDQQRVNOIHJNX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|