C17H16F2N2O3 — CID 90719592
ethyl 3-[6-[2-(2,4-difluorophenyl)ethyl]pyrimidin-4-yl]-2-oxopropanoate (PubChem CID 90719592) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is ethyl 3-[6-[2-(2,4-difluorophenyl)ethyl]pyrimidin-4-yl]-2-oxopropanoate.
| Compound Name | ethyl 3-[6-[2-(2,4-difluorophenyl)ethyl]pyrimidin-4-yl]-2-oxopropanoate |
|---|---|
| PubChem CID | 90719592 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | ethyl 3-[6-[2-(2,4-difluorophenyl)ethyl]pyrimidin-4-yl]-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)Cc1cc(CCc2ccc(F)cc2F)ncn1 |
| InChI | InChI=1S/C17H16F2N2O3/c1-2-24-17(23)16(22)9-14-8-13(20-10-21-14)6-4-11-3-5-12(18)7-15(11)19/h3,5,7-8,10H,2,4,6,9H2,1H3 |
| InChIKey | QWLPVRXLBHHUHE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|