C24H22F2N2O3 — CID 91135890
ethyl 3-[6-[1,3-bis(4-fluorophenyl)propan-2-yl]pyrimidin-4-yl]-2-oxopropanoate (PubChem CID 91135890) has the molecular formula C24H22F2N2O3 and a molecular weight of 424.45 g/mol. Its IUPAC name is ethyl 3-[6-[1,3-bis(4-fluorophenyl)propan-2-yl]pyrimidin-4-yl]-2-oxopropanoate.
| Compound Name | ethyl 3-[6-[1,3-bis(4-fluorophenyl)propan-2-yl]pyrimidin-4-yl]-2-oxopropanoate |
|---|---|
| PubChem CID | 91135890 |
| Molecular Formula | C24H22F2N2O3 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | ethyl 3-[6-[1,3-bis(4-fluorophenyl)propan-2-yl]pyrimidin-4-yl]-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)Cc1cc(C(Cc2ccc(F)cc2)Cc2ccc(F)cc2)ncn1 |
| InChI | InChI=1S/C24H22F2N2O3/c1-2-31-24(30)23(29)14-21-13-22(28-15-27-21)18(11-16-3-7-19(25)8-4-16)12-17-5-9-20(26)10-6-17/h3-10,13,15,18H,2,11-12,14H2,1H3 |
| InChIKey | QMQBSEXUYVPLLJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|