(4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate

C13H20O6 — CID 90719791

IUPAC(4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate
SMILESC=CC(=O)OCCC(=O)OC1OC(C)CC(CC)O1
InChIInChI=1S/C13H20O6/c1-4-10-8-9(3)17-13(18-10)19-12(15)6-7-16-11(14)5-2/h5,9-10,13H,2,4,6-8H2,1,3H3
InChIKeySNCGGBBMDQQPSG-UHFFFAOYSA-N
MW272.30 g/mol
LogP1.54
Rot. Bonds6

About (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate

(4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate (PubChem CID 90719791) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate.

Molecular Properties

Compound Name(4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate
PubChem CID90719791
Molecular FormulaC13H20O6
Molecular Weight272.30 g/mol
Exact Mass272.13
IUPAC Name(4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate
SMILESC=CC(=O)OCCC(=O)OC1OC(C)CC(CC)O1
InChIInChI=1S/C13H20O6/c1-4-10-8-9(3)17-13(18-10)19-12(15)6-7-16-11(14)5-2/h5,9-10,13H,2,4,6-8H2,1,3H3
InChIKeySNCGGBBMDQQPSG-UHFFFAOYSA-N
XLogP1.54
TPSA71.06 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.30
LogP ≤ 51.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate?
The IUPAC name of (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate (CID 90719791) is (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate.
What is the SMILES notation for (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate?
The canonical SMILES for (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate is C=CC(=O)OCCC(=O)OC1OC(C)CC(CC)O1.
What is the InChIKey of (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate?
The InChIKey is SNCGGBBMDQQPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O6/c1-4-10-8-9(3)17-13(18-10)19-12(15)6-7-16-11(14)5-2/h5,9-10,13H,2,4,6-8H2,1,3H3.
What are the key properties of (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate?
(4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate has a molecular weight of 272.30 g/mol, XLogP of 1.54, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-6-methyl-1,3-dioxan-2-yl) 3-prop-2-enoyloxypropanoate is sourced from PubChem (CID 90719791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).