C19H26N4+2 — CID 90719957
(1S)-2,14-diaza-6,19-diazoniapentacyclo[10.6.1.02,6.08,19.014,18]nonadeca-3,5,8,10,12(19),15,17-heptaene;ethane (PubChem CID 90719957) has the molecular formula C19H26N4+2 and a molecular weight of 310.45 g/mol. Its IUPAC name is (1S)-2,14-diaza-6,19-diazoniapentacyclo[10.6.1.02,6.08,19.014,18]nonadeca-3,5,8,10,12(19),15,17-heptaene;ethane.
| Compound Name | (1S)-2,14-diaza-6,19-diazoniapentacyclo[10.6.1.02,6.08,19.014,18]nonadeca-3,5,8,10,12(19),15,17-heptaene;ethane |
|---|---|
| PubChem CID | 90719957 |
| Molecular Formula | C19H26N4+2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (1S)-2,14-diaza-6,19-diazoniapentacyclo[10.6.1.02,6.08,19.014,18]nonadeca-3,5,8,10,12(19),15,17-heptaene;ethane |
| SMILES | CC.CC.c1cc2[n+]3c(c1)C[n+]1cccn1[C@H]3c1cccn1C2 |
| InChI | InChI=1S/C15H14N4.2C2H6/c1-4-12-10-16-7-2-6-14(16)15-18-9-3-8-17(18)11-13(5-1)19(12)15;2*1-2/h1-9,15H,10-11H2;2*1-2H3/q+2;;/t15-;;/m1../s1 |
| InChIKey | IHYUKMICFIIYRQ-QCUBGVIVSA-N |
| XLogP | 2.74 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|