About 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid
2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid (PubChem CID 90720662) has the molecular formula C20H21N3O4
and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid |
| PubChem CID | 90720662 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid |
| SMILES | O=CNc1c(CC(=O)O)ccc2c1c1c(O)cncc1n2CC1CCCC1 |
| InChI | InChI=1S/C20H21N3O4/c24-11-22-20-13(7-17(26)27)5-6-14-19(20)18-15(8-21-9-16(18)25)23(14)10-12-3-1-2-4-12/h5-6,8-9,11-12,25H,1-4,7,10H2,(H,22,24)(H,26,27) |
| InChIKey | WKMPJIBQNDFFQX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid?
The IUPAC name of 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid (CID 90720662) is 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid.
What is the SMILES notation for 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid?
The canonical SMILES for 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid is O=CNc1c(CC(=O)O)ccc2c1c1c(O)cncc1n2CC1CCCC1.
What is the InChIKey of 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid?
The InChIKey is WKMPJIBQNDFFQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O4/c24-11-22-20-13(7-17(26)27)5-6-14-19(20)18-15(8-21-9-16(18)25)23(14)10-12-3-1-2-4-12/h5-6,8-9,11-12,25H,1-4,7,10H2,(H,22,24)(H,26,27).
What are the key properties of 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid?
2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid has a molecular weight of 367.41 g/mol, XLogP of 3.28, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[9-(cyclopentylmethyl)-5-formamido-4-hydroxypyrido[3,4-b]indol-6-yl]acetic acid is sourced from PubChem (CID 90720662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).