C36H50N5O5+ — CID 90721326
(4-hydroxy-3,5-dimethylphenyl)methyl (2R,4R)-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)-2-(1-piperidin-4-ylpiperidin-1-ium-1-yl)piperidine-1-carboxylate (PubChem CID 90721326) has the molecular formula C36H50N5O5+ and a molecular weight of 632.83 g/mol. Its IUPAC name is (4-hydroxy-3,5-dimethylphenyl)methyl (2R,4R)-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)-2-(1-piperidin-4-ylpiperidin-1-ium-1-yl)piperidine-1-carboxylate.
| Compound Name | (4-hydroxy-3,5-dimethylphenyl)methyl (2R,4R)-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)-2-(1-piperidin-4-ylpiperidin-1-ium-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90721326 |
| Molecular Formula | C36H50N5O5+ |
| Molecular Weight | 632.83 g/mol |
| Exact Mass | 632.38 |
| IUPAC Name | (4-hydroxy-3,5-dimethylphenyl)methyl (2R,4R)-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)-2-(1-piperidin-4-ylpiperidin-1-ium-1-yl)piperidine-1-carboxylate |
| SMILES | Cc1cc(COC(=O)N2CC[C@@H](N3CCc4ccccc4NC3=O)C[C@]2(CC=O)[N+]2(C3CCNCC3)CCCCC2)cc(C)c1O |
| InChI | InChI=1S/C36H49N5O5/c1-26-22-28(23-27(2)33(26)43)25-46-35(45)40-18-13-30(39-17-12-29-8-4-5-9-32(29)38-34(39)44)24-36(40,14-21-42)41(19-6-3-7-20-41)31-10-15-37-16-11-31/h4-5,8-9,21-23,30-31,37H,3,6-7,10-20,24-25H2,1-2H3,(H-,38,43,44)/p+1/t30-,36+/m1/s1 |
| InChIKey | JHOCSYHZMCNESU-GERKYKROSA-O |
| XLogP | 5.24 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.83 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|