C35H47N5O5 — CID 90836004
(4-hydroxy-3,5-dimethylphenyl)methyl (2R,4R)-2-(4-cyclopentylpiperazin-1-yl)-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidine-1-carboxylate (PubChem CID 90836004) has the molecular formula C35H47N5O5 and a molecular weight of 617.79 g/mol. Its IUPAC name is (4-hydroxy-3,5-dimethylphenyl)methyl (2R,4R)-2-(4-cyclopentylpiperazin-1-yl)-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidine-1-carboxylate.
| Compound Name | (4-hydroxy-3,5-dimethylphenyl)methyl (2R,4R)-2-(4-cyclopentylpiperazin-1-yl)-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90836004 |
| Molecular Formula | C35H47N5O5 |
| Molecular Weight | 617.79 g/mol |
| Exact Mass | 617.36 |
| IUPAC Name | (4-hydroxy-3,5-dimethylphenyl)methyl (2R,4R)-2-(4-cyclopentylpiperazin-1-yl)-4-(2-oxo-4,5-dihydro-1H-1,3-benzodiazepin-3-yl)-2-(2-oxoethyl)piperidine-1-carboxylate |
| SMILES | Cc1cc(COC(=O)N2CC[C@@H](N3CCc4ccccc4NC3=O)C[C@@]2(CC=O)N2CCN(C3CCCC3)CC2)cc(C)c1O |
| InChI | InChI=1S/C35H47N5O5/c1-25-21-27(22-26(2)32(25)42)24-45-34(44)40-15-12-30(39-14-11-28-7-3-6-10-31(28)36-33(39)43)23-35(40,13-20-41)38-18-16-37(17-19-38)29-8-4-5-9-29/h3,6-7,10,20-22,29-30,42H,4-5,8-9,11-19,23-24H2,1-2H3,(H,36,43)/t30-,35+/m1/s1 |
| InChIKey | FYPTYVJKDVTYHA-BIMVPBQRSA-N |
| XLogP | 5.05 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|