About 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate
2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate (PubChem CID 90721411) has the molecular formula C9H21N3O6S4
and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate.
Molecular Properties
| Compound Name | 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate |
| PubChem CID | 90721411 |
| Molecular Formula | C9H21N3O6S4 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate |
| SMILES | CCCSSCCO[N+](=O)[O-].NCCSSCCO[N+](=O)[O-] |
| InChI | InChI=1S/C5H11NO3S2.C4H10N2O3S2/c1-2-4-10-11-5-3-9-6(7)8;5-1-3-10-11-4-2-9-6(7)8/h2-5H2,1H3;1-5H2 |
| InChIKey | NOLDSEVKYNJQJY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate?
The IUPAC name of 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate (CID 90721411) is 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate.
What is the SMILES notation for 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate?
The canonical SMILES for 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate is CCCSSCCO[N+](=O)[O-].NCCSSCCO[N+](=O)[O-].
What is the InChIKey of 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate?
The InChIKey is NOLDSEVKYNJQJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3S2.C4H10N2O3S2/c1-2-4-10-11-5-3-9-6(7)8;5-1-3-10-11-4-2-9-6(7)8/h2-5H2,1H3;1-5H2.
What are the key properties of 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate?
2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate has a molecular weight of 395.55 g/mol, XLogP of 2.52, 14 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyldisulfanyl)ethyl nitrate;2-(propyldisulfanyl)ethyl nitrate is sourced from PubChem (CID 90721411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).