About 2-aminoethanol;2-nitrooxyethylazanium;nitrate
2-aminoethanol;2-nitrooxyethylazanium;nitrate (PubChem CID 160840712) has the molecular formula C4H14N4O7
and a molecular weight of 230.18 g/mol. Its IUPAC name is 2-aminoethanol;2-nitrooxyethylazanium;nitrate.
Molecular Properties
| Compound Name | 2-aminoethanol;2-nitrooxyethylazanium;nitrate |
| PubChem CID | 160840712 |
| Molecular Formula | C4H14N4O7 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-aminoethanol;2-nitrooxyethylazanium;nitrate |
| SMILES | NCCO.O=[N+]([O-])[O-].[NH3+]CCO[N+](=O)[O-] |
| InChI | InChI=1S/C2H6N2O3.C2H7NO.NO3/c3-1-2-7-4(5)6;3-1-2-4;2-1(3)4/h1-3H2;4H,1-3H2;/q;;-1/p+1 |
| InChIKey | SHZJMMJNSYLARA-UHFFFAOYSA-O |
| XLogP | -2.87 |
| TPSA | 192.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;2-nitrooxyethylazanium;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;2-nitrooxyethylazanium;nitrate?
The IUPAC name of 2-aminoethanol;2-nitrooxyethylazanium;nitrate (CID 160840712) is 2-aminoethanol;2-nitrooxyethylazanium;nitrate.
What is the SMILES notation for 2-aminoethanol;2-nitrooxyethylazanium;nitrate?
The canonical SMILES for 2-aminoethanol;2-nitrooxyethylazanium;nitrate is NCCO.O=[N+]([O-])[O-].[NH3+]CCO[N+](=O)[O-].
What is the InChIKey of 2-aminoethanol;2-nitrooxyethylazanium;nitrate?
The InChIKey is SHZJMMJNSYLARA-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H6N2O3.C2H7NO.NO3/c3-1-2-7-4(5)6;3-1-2-4;2-1(3)4/h1-3H2;4H,1-3H2;/q;;-1/p+1.
What are the key properties of 2-aminoethanol;2-nitrooxyethylazanium;nitrate?
2-aminoethanol;2-nitrooxyethylazanium;nitrate has a molecular weight of 230.18 g/mol, XLogP of -2.87, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;2-nitrooxyethylazanium;nitrate is sourced from PubChem (CID 160840712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).