C24H25ClFN5OS2 — CID 90722109
1-[[4-chloro-2-[3-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methylsulfanyl]-3-cyanothiourea (PubChem CID 90722109) has the molecular formula C24H25ClFN5OS2 and a molecular weight of 518.08 g/mol. Its IUPAC name is 1-[[4-chloro-2-[3-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methylsulfanyl]-3-cyanothiourea.
| Compound Name | 1-[[4-chloro-2-[3-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methylsulfanyl]-3-cyanothiourea |
|---|---|
| PubChem CID | 90722109 |
| Molecular Formula | C24H25ClFN5OS2 |
| Molecular Weight | 518.08 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 1-[[4-chloro-2-[3-[4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]methylsulfanyl]-3-cyanothiourea |
| SMILES | CC1CN(Cc2ccc(F)cc2)CCN1C(=O)C=Cc1cc(Cl)ccc1CSNC(=S)NC#N |
| InChI | InChI=1S/C24H25ClFN5OS2/c1-17-13-30(14-18-2-7-22(26)8-3-18)10-11-31(17)23(32)9-5-19-12-21(25)6-4-20(19)15-34-29-24(33)28-16-27/h2-9,12,17H,10-11,13-15H2,1H3,(H2,28,29,33) |
| InChIKey | QPCRVZMDCZPKTQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.08 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|