C23H21N7O4 — CID 90722162
ethyl 4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]quinolin-3-yl]pyrimidine-5-carboxylate (PubChem CID 90722162) has the molecular formula C23H21N7O4 and a molecular weight of 459.47 g/mol. Its IUPAC name is ethyl 4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]quinolin-3-yl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]quinolin-3-yl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 90722162 |
| Molecular Formula | C23H21N7O4 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | ethyl 4-[2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]quinolin-3-yl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cncnc1-c1cc2ccccc2nc1NCCNc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C23H21N7O4/c1-2-34-23(31)18-13-24-14-28-21(18)17-11-15-5-3-4-6-19(15)29-22(17)26-10-9-25-20-8-7-16(12-27-20)30(32)33/h3-8,11-14H,2,9-10H2,1H3,(H,25,27)(H,26,29) |
| InChIKey | CUYHHJZXJNJLHV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 145.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|