C31H35FN2O7 — CID 90722645
(4aR,5aS,12aR)-4-(dimethylamino)-7-[4-(4-fluorobutyl)phenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 90722645) has the molecular formula C31H35FN2O7 and a molecular weight of 566.63 g/mol. Its IUPAC name is (4aR,5aS,12aR)-4-(dimethylamino)-7-[4-(4-fluorobutyl)phenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aR)-4-(dimethylamino)-7-[4-(4-fluorobutyl)phenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90722645 |
| Molecular Formula | C31H35FN2O7 |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | (4aR,5aS,12aR)-4-(dimethylamino)-7-[4-(4-fluorobutyl)phenyl]-3,10,12a-trihydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(O)ccc(-c5ccc(CCCCF)cc5)c4C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C31H35FN2O7/c1-34(2)25-20-14-17-13-19-18(16-8-6-15(7-9-16)5-3-4-12-32)10-11-21(35)23(19)26(36)22(17)28(38)31(20,41)29(39)24(27(25)37)30(33)40/h6-11,17,20,22,24-25,27,35,37,41H,3-5,12-14H2,1-2H3,(H2,33,40)/t17-,20-,22?,24?,25?,27?,31-/m1/s1 |
| InChIKey | FYVSRIRTZLINCB-LVUYXURXSA-N |
| XLogP | 1.62 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|