C21H21ClN8O5 — CID 90722972
4-chloro-N-[1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(methylamino)purin-2-yl]pyrazol-4-yl]benzamide (PubChem CID 90722972) has the molecular formula C21H21ClN8O5 and a molecular weight of 500.90 g/mol. Its IUPAC name is 4-chloro-N-[1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(methylamino)purin-2-yl]pyrazol-4-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(methylamino)purin-2-yl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 90722972 |
| Molecular Formula | C21H21ClN8O5 |
| Molecular Weight | 500.90 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 4-chloro-N-[1-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(methylamino)purin-2-yl]pyrazol-4-yl]benzamide |
| SMILES | CNc1nc(-n2cc(NC(=O)c3ccc(Cl)cc3)cn2)nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H21ClN8O5/c1-23-17-14-18(29(9-24-14)20-16(33)15(32)13(8-31)35-20)28-21(27-17)30-7-12(6-25-30)26-19(34)10-2-4-11(22)5-3-10/h2-7,9,13,15-16,20,31-33H,8H2,1H3,(H,26,34)(H,23,27,28)/t13-,15-,16-,20-/m1/s1 |
| InChIKey | VWEOZGCXUBSJHJ-KHTYJDQRSA-N |
| XLogP | 0.57 |
| TPSA | 172.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.90 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |