C22H38BrNOSi — CID 90723233
[7-(6-bromo-2-pyridinyl)-3-ethylnon-6-en-3-yl]oxy-triethylsilane (PubChem CID 90723233) has the molecular formula C22H38BrNOSi and a molecular weight of 440.54 g/mol. Its IUPAC name is [7-(6-bromo-2-pyridinyl)-3-ethylnon-6-en-3-yl]oxy-triethylsilane.
| Compound Name | [7-(6-bromo-2-pyridinyl)-3-ethylnon-6-en-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 90723233 |
| Molecular Formula | C22H38BrNOSi |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | [7-(6-bromo-2-pyridinyl)-3-ethylnon-6-en-3-yl]oxy-triethylsilane |
| SMILES | CCC(=CCCC(CC)(CC)O[Si](CC)(CC)CC)c1cccc(Br)n1 |
| InChI | InChI=1S/C22H38BrNOSi/c1-7-19(20-16-13-17-21(23)24-20)15-14-18-22(8-2,9-3)25-26(10-4,11-5)12-6/h13,15-17H,7-12,14,18H2,1-6H3 |
| InChIKey | KSFXGOPNOQPGFE-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|