C31H46O6SSi — CID 20636313
dimethyl 4-[[5-[(E)-6-ethyl-6-triethylsilyloxyoct-2-en-2-yl]thiophen-3-yl]methoxy]benzene-1,2-dicarboxylate (PubChem CID 20636313) has the molecular formula C31H46O6SSi and a molecular weight of 574.86 g/mol. Its IUPAC name is dimethyl 4-[[5-[(E)-6-ethyl-6-triethylsilyloxyoct-2-en-2-yl]thiophen-3-yl]methoxy]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[[5-[(E)-6-ethyl-6-triethylsilyloxyoct-2-en-2-yl]thiophen-3-yl]methoxy]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 20636313 |
| Molecular Formula | C31H46O6SSi |
| Molecular Weight | 574.86 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | dimethyl 4-[[5-[(E)-6-ethyl-6-triethylsilyloxyoct-2-en-2-yl]thiophen-3-yl]methoxy]benzene-1,2-dicarboxylate |
| SMILES | CCC(CC)(CC/C=C(\C)c1cc(COc2ccc(C(=O)OC)c(C(=O)OC)c2)cs1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C31H46O6SSi/c1-9-31(10-2,37-39(11-3,12-4)13-5)18-14-15-23(6)28-19-24(22-38-28)21-36-25-16-17-26(29(32)34-7)27(20-25)30(33)35-8/h15-17,19-20,22H,9-14,18,21H2,1-8H3/b23-15+ |
| InChIKey | BFWUVDZNXCOQLU-HZHRSRAPSA-N |
| XLogP | 8.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.86 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|