C23H28O6S — CID 91241868
4-[[2-(6-ethyl-6-hydroxyoct-2-en-2-yl)thiophen-3-yl]methoxy]phthalic acid (PubChem CID 91241868) has the molecular formula C23H28O6S and a molecular weight of 432.54 g/mol. Its IUPAC name is 4-[[2-(6-ethyl-6-hydroxyoct-2-en-2-yl)thiophen-3-yl]methoxy]phthalic acid.
| Compound Name | 4-[[2-(6-ethyl-6-hydroxyoct-2-en-2-yl)thiophen-3-yl]methoxy]phthalic acid |
|---|---|
| PubChem CID | 91241868 |
| Molecular Formula | C23H28O6S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 4-[[2-(6-ethyl-6-hydroxyoct-2-en-2-yl)thiophen-3-yl]methoxy]phthalic acid |
| SMILES | CCC(O)(CC)CCC=C(C)c1sccc1COc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H28O6S/c1-4-23(28,5-2)11-6-7-15(3)20-16(10-12-30-20)14-29-17-8-9-18(21(24)25)19(13-17)22(26)27/h7-10,12-13,28H,4-6,11,14H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | KPSDLPCTSSBMRG-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |