C27H34O6 — CID 23439723
dimethyl 4-[[3-[(Z)-8-hydroxy-8-methylnon-2-en-2-yl]phenoxy]methyl]benzene-1,2-dicarboxylate (PubChem CID 23439723) has the molecular formula C27H34O6 and a molecular weight of 454.56 g/mol. Its IUPAC name is dimethyl 4-[[3-[(Z)-8-hydroxy-8-methylnon-2-en-2-yl]phenoxy]methyl]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[[3-[(Z)-8-hydroxy-8-methylnon-2-en-2-yl]phenoxy]methyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23439723 |
| Molecular Formula | C27H34O6 |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | dimethyl 4-[[3-[(Z)-8-hydroxy-8-methylnon-2-en-2-yl]phenoxy]methyl]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(COc2cccc(/C(C)=C\CCCCC(C)(C)O)c2)cc1C(=O)OC |
| InChI | InChI=1S/C27H34O6/c1-19(10-7-6-8-15-27(2,3)30)21-11-9-12-22(17-21)33-18-20-13-14-23(25(28)31-4)24(16-20)26(29)32-5/h9-14,16-17,30H,6-8,15,18H2,1-5H3/b19-10- |
| InChIKey | SRCVZUYCHSXYFU-GRSHGNNSSA-N |
| XLogP | 5.57 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|