C25H30O4 — CID 87435429
(Z)-7-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethyloct-6-en-4-yn-3-ol (PubChem CID 87435429) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is (Z)-7-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethyloct-6-en-4-yn-3-ol.
| Compound Name | (Z)-7-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethyloct-6-en-4-yn-3-ol |
|---|---|
| PubChem CID | 87435429 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (Z)-7-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethyloct-6-en-4-yn-3-ol |
| SMILES | CCC(O)(C#C/C=C(/C)c1cccc(OCc2ccc(CO)c(CO)c2)c1)CC |
| InChI | InChI=1S/C25H30O4/c1-4-25(28,5-2)13-7-8-19(3)21-9-6-10-24(15-21)29-18-20-11-12-22(16-26)23(14-20)17-27/h6,8-12,14-15,26-28H,4-5,16-18H2,1-3H3/b19-8- |
| InChIKey | DTOLIBFLEFMRIJ-UWVJOHFNSA-N |
| XLogP | 4.21 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|