C25H32O4 — CID 57058058
7-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethylocta-4,6-dien-3-ol (PubChem CID 57058058) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is 7-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethylocta-4,6-dien-3-ol.
| Compound Name | 7-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethylocta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 57058058 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 7-[3-[[3,4-bis(hydroxymethyl)phenyl]methoxy]phenyl]-3-ethylocta-4,6-dien-3-ol |
| SMILES | CCC(O)(C=CC=C(C)c1cccc(OCc2ccc(CO)c(CO)c2)c1)CC |
| InChI | InChI=1S/C25H32O4/c1-4-25(28,5-2)13-7-8-19(3)21-9-6-10-24(15-21)29-18-20-11-12-22(16-26)23(14-20)17-27/h6-15,26-28H,4-5,16-18H2,1-3H3 |
| InChIKey | OQWVSCCJZONDIX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|