C38H60O3Si2 — CID 86759337
CID 86759337 (PubChem CID 86759337) has the molecular formula C38H60O3Si2 and a molecular weight of 621.07 g/mol.
| Compound Name | CID 86759337 |
|---|---|
| PubChem CID | 86759337 |
| Molecular Formula | C38H60O3Si2 |
| Molecular Weight | 621.07 g/mol |
| Exact Mass | 620.41 |
| IUPAC Name | — |
| SMILES | CCC(O)(/C=C/C=C(\C)c1cccc(CCc2ccc(C(O[Si](C)C)C(C)(C)C)c(C(O[Si](C)C)C(C)(C)C)c2)c1)CC |
| InChI | InChI=1S/C38H60O3Si2/c1-14-38(39,15-2)25-17-18-28(3)31-20-16-19-29(26-31)21-22-30-23-24-32(34(36(4,5)6)40-42(10)11)33(27-30)35(37(7,8)9)41-43(12)13/h16-20,23-27,34-35,39H,14-15,21-22H2,1-13H3/b25-17+,28-18+ |
| InChIKey | CJFPUORBQPGQOS-KWCUBGNDSA-N |
| XLogP | 10.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.07 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|