C30H40O3 — CID 129270308
5-[2-[3-[(3E,5E)-7-ethyl-7-hydroxynona-3,5-dien-3-yl]phenyl]ethyl]-2,2-dimethyl-1,3-dihydroindene-1,3-diol (PubChem CID 129270308) has the molecular formula C30H40O3 and a molecular weight of 448.65 g/mol. Its IUPAC name is 5-[2-[3-[(3E,5E)-7-ethyl-7-hydroxynona-3,5-dien-3-yl]phenyl]ethyl]-2,2-dimethyl-1,3-dihydroindene-1,3-diol.
| Compound Name | 5-[2-[3-[(3E,5E)-7-ethyl-7-hydroxynona-3,5-dien-3-yl]phenyl]ethyl]-2,2-dimethyl-1,3-dihydroindene-1,3-diol |
|---|---|
| PubChem CID | 129270308 |
| Molecular Formula | C30H40O3 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 5-[2-[3-[(3E,5E)-7-ethyl-7-hydroxynona-3,5-dien-3-yl]phenyl]ethyl]-2,2-dimethyl-1,3-dihydroindene-1,3-diol |
| SMILES | CC/C(=C\C=C\C(O)(CC)CC)c1cccc(CCc2ccc3c(c2)C(O)C(C)(C)C3O)c1 |
| InChI | InChI=1S/C30H40O3/c1-6-23(13-10-18-30(33,7-2)8-3)24-12-9-11-21(19-24)14-15-22-16-17-25-26(20-22)28(32)29(4,5)27(25)31/h9-13,16-20,27-28,31-33H,6-8,14-15H2,1-5H3/b18-10+,23-13+ |
| InChIKey | FHOJXIFCPXZLKN-OFNXDONCSA-N |
| XLogP | 6.48 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|